C12H12BrNO — CID 24905549
(4S,5R)-4-(4-bromophenyl)-5-methyl-3-methylidenepyrrolidin-2-one (PubChem CID 24905549) has the molecular formula C12H12BrNO and a molecular weight of 266.14 g/mol. Its IUPAC name is (4S,5R)-4-(4-bromophenyl)-5-methyl-3-methylidenepyrrolidin-2-one.
| Compound Name | (4S,5R)-4-(4-bromophenyl)-5-methyl-3-methylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 24905549 |
| Molecular Formula | C12H12BrNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | (4S,5R)-4-(4-bromophenyl)-5-methyl-3-methylidenepyrrolidin-2-one |
| SMILES | C=C1C(=O)N[C@H](C)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H12BrNO/c1-7-11(8(2)14-12(7)15)9-3-5-10(13)6-4-9/h3-6,8,11H,1H2,2H3,(H,14,15)/t8-,11+/m1/s1 |
| InChIKey | DYWMPWBVAWQIPD-KCJUWKMLSA-N |
| XLogP | 2.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|