C12H20OS2 — CID 24905799
(E,3R)-4-(1,3-dithian-2-ylidene)-3-methylhept-5-en-1-ol (PubChem CID 24905799) has the molecular formula C12H20OS2 and a molecular weight of 244.42 g/mol. Its IUPAC name is (E,3R)-4-(1,3-dithian-2-ylidene)-3-methylhept-5-en-1-ol.
| Compound Name | (E,3R)-4-(1,3-dithian-2-ylidene)-3-methylhept-5-en-1-ol |
|---|---|
| PubChem CID | 24905799 |
| Molecular Formula | C12H20OS2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (E,3R)-4-(1,3-dithian-2-ylidene)-3-methylhept-5-en-1-ol |
| SMILES | C/C=C/C(=C1SCCCS1)[C@H](C)CCO |
| InChI | InChI=1S/C12H20OS2/c1-3-5-11(10(2)6-7-13)12-14-8-4-9-15-12/h3,5,10,13H,4,6-9H2,1-2H3/b5-3+/t10-/m1/s1 |
| InChIKey | HISGRFVCSSWCTQ-RXNUUUNCSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |