C11H20OS — CID 143506484
(Z,4Z)-4-ethylidene-3-methyl-7-methylsulfanylhept-5-en-1-ol (PubChem CID 143506484) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is (Z,4Z)-4-ethylidene-3-methyl-7-methylsulfanylhept-5-en-1-ol.
| Compound Name | (Z,4Z)-4-ethylidene-3-methyl-7-methylsulfanylhept-5-en-1-ol |
|---|---|
| PubChem CID | 143506484 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (Z,4Z)-4-ethylidene-3-methyl-7-methylsulfanylhept-5-en-1-ol |
| SMILES | C/C=C(\C=C/CSC)C(C)CCO |
| InChI | InChI=1S/C11H20OS/c1-4-11(6-5-9-13-3)10(2)7-8-12/h4-6,10,12H,7-9H2,1-3H3/b6-5-,11-4+ |
| InChIKey | ZCLFVNHVUZUASS-VWXLBWAMSA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|