C12H18OS — CID 123423530
3,4-dimethylidene-7-methylsulfanylnona-5,7-dien-1-ol (PubChem CID 123423530) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 3,4-dimethylidene-7-methylsulfanylnona-5,7-dien-1-ol.
| Compound Name | 3,4-dimethylidene-7-methylsulfanylnona-5,7-dien-1-ol |
|---|---|
| PubChem CID | 123423530 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3,4-dimethylidene-7-methylsulfanylnona-5,7-dien-1-ol |
| SMILES | C=C(C=CC(=CC)SC)C(=C)CCO |
| InChI | InChI=1S/C12H18OS/c1-5-12(14-4)7-6-10(2)11(3)8-9-13/h5-7,13H,2-3,8-9H2,1,4H3 |
| InChIKey | IRXPHIWXJYBBJZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|