C9H16OS — CID 123770797
4-methylsulfanylocta-4,6-dien-1-ol (PubChem CID 123770797) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is 4-methylsulfanylocta-4,6-dien-1-ol.
| Compound Name | 4-methylsulfanylocta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 123770797 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 4-methylsulfanylocta-4,6-dien-1-ol |
| SMILES | CC=CC=C(CCCO)SC |
| InChI | InChI=1S/C9H16OS/c1-3-4-6-9(11-2)7-5-8-10/h3-4,6,10H,5,7-8H2,1-2H3 |
| InChIKey | VMKNGTKQECBHKC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|