C21H34OS — CID 59492233
(4E,8Z,11Z,14Z,17Z)-2-methylsulfanylicosa-4,8,11,14,17-pentaen-1-ol (PubChem CID 59492233) has the molecular formula C21H34OS and a molecular weight of 334.57 g/mol. Its IUPAC name is (4E,8Z,11Z,14Z,17Z)-2-methylsulfanylicosa-4,8,11,14,17-pentaen-1-ol.
| Compound Name | (4E,8Z,11Z,14Z,17Z)-2-methylsulfanylicosa-4,8,11,14,17-pentaen-1-ol |
|---|---|
| PubChem CID | 59492233 |
| Molecular Formula | C21H34OS |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (4E,8Z,11Z,14Z,17Z)-2-methylsulfanylicosa-4,8,11,14,17-pentaen-1-ol |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CC/C=C/CC(CO)SC |
| InChI | InChI=1S/C21H34OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(20-22)23-2/h4-5,7-8,10-11,13-14,17-18,21-22H,3,6,9,12,15-16,19-20H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,18-17+ |
| InChIKey | WRPGHMLSSXWVDG-MZESORTBSA-N |
| XLogP | 6.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|