C12H24OS — CID 143267514
ethane;(6Z)-6-methylsulfanylnona-6,8-dien-4-ol (PubChem CID 143267514) has the molecular formula C12H24OS and a molecular weight of 216.39 g/mol. Its IUPAC name is ethane;(6Z)-6-methylsulfanylnona-6,8-dien-4-ol.
| Compound Name | ethane;(6Z)-6-methylsulfanylnona-6,8-dien-4-ol |
|---|---|
| PubChem CID | 143267514 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | ethane;(6Z)-6-methylsulfanylnona-6,8-dien-4-ol |
| SMILES | C=C/C=C(/CC(O)CCC)SC.CC |
| InChI | InChI=1S/C10H18OS.C2H6/c1-4-6-9(11)8-10(12-3)7-5-2;1-2/h5,7,9,11H,2,4,6,8H2,1,3H3;1-2H3/b10-7-; |
| InChIKey | CPBWULFXRQXIBH-VEZAGKLZSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|