C13H20OS — CID 143876791
3-[3-methyl-5-(2-sulfanylethyl)cyclohepta-1,4,6-trien-1-yl]propan-1-ol (PubChem CID 143876791) has the molecular formula C13H20OS and a molecular weight of 224.37 g/mol. Its IUPAC name is 3-[3-methyl-5-(2-sulfanylethyl)cyclohepta-1,4,6-trien-1-yl]propan-1-ol.
| Compound Name | 3-[3-methyl-5-(2-sulfanylethyl)cyclohepta-1,4,6-trien-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 143876791 |
| Molecular Formula | C13H20OS |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-[3-methyl-5-(2-sulfanylethyl)cyclohepta-1,4,6-trien-1-yl]propan-1-ol |
| SMILES | CC1C=C(CCS)C=CC(CCCO)=C1 |
| InChI | InChI=1S/C13H20OS/c1-11-9-12(3-2-7-14)4-5-13(10-11)6-8-15/h4-5,9-11,14-15H,2-3,6-8H2,1H3 |
| InChIKey | PRBLTFNRQMXXEV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|