C11H16OS — CID 142237051
(4Z,6E)-8-methylidene-7-sulfanyldeca-4,6,9-trien-1-ol (PubChem CID 142237051) has the molecular formula C11H16OS and a molecular weight of 196.31 g/mol. Its IUPAC name is (4Z,6E)-8-methylidene-7-sulfanyldeca-4,6,9-trien-1-ol.
| Compound Name | (4Z,6E)-8-methylidene-7-sulfanyldeca-4,6,9-trien-1-ol |
|---|---|
| PubChem CID | 142237051 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (4Z,6E)-8-methylidene-7-sulfanyldeca-4,6,9-trien-1-ol |
| SMILES | C=CC(=C)/C(S)=C\C=C/CCCO |
| InChI | InChI=1S/C11H16OS/c1-3-10(2)11(13)8-6-4-5-7-9-12/h3-4,6,8,12-13H,1-2,5,7,9H2/b6-4-,11-8+ |
| InChIKey | AKTHJCQQQUQWPU-XSMBNUTRSA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|