C10H16O — CID 88961777
(3Z,4Z)-3-ethylidene-5-methylhepta-4,6-dien-1-ol (PubChem CID 88961777) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (3Z,4Z)-3-ethylidene-5-methylhepta-4,6-dien-1-ol.
| Compound Name | (3Z,4Z)-3-ethylidene-5-methylhepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 88961777 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (3Z,4Z)-3-ethylidene-5-methylhepta-4,6-dien-1-ol |
| SMILES | C=C/C(C)=C\C(=C/C)CCO |
| InChI | InChI=1S/C10H16O/c1-4-9(3)8-10(5-2)6-7-11/h4-5,8,11H,1,6-7H2,2-3H3/b9-8-,10-5- |
| InChIKey | HEXRVSTWIVJYEW-FJPHMEQPSA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|