C14H30OS — CID 143876716
(3E,5E)-3,6-dimethyl-8-sulfanylocta-3,5-dien-1-ol;ethane (PubChem CID 143876716) has the molecular formula C14H30OS and a molecular weight of 246.46 g/mol. Its IUPAC name is (3E,5E)-3,6-dimethyl-8-sulfanylocta-3,5-dien-1-ol;ethane.
| Compound Name | (3E,5E)-3,6-dimethyl-8-sulfanylocta-3,5-dien-1-ol;ethane |
|---|---|
| PubChem CID | 143876716 |
| Molecular Formula | C14H30OS |
| Molecular Weight | 246.46 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (3E,5E)-3,6-dimethyl-8-sulfanylocta-3,5-dien-1-ol;ethane |
| SMILES | C/C(=C\C=C(/C)CCS)CCO.CC.CC |
| InChI | InChI=1S/C10H18OS.2C2H6/c1-9(5-7-11)3-4-10(2)6-8-12;2*1-2/h3-4,11-12H,5-8H2,1-2H3;2*1-2H3/b9-3+,10-4+;; |
| InChIKey | GFSRRRGINYRBOW-PCXJSBAJSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|