C7H12OS — CID 89366187
(3E,5Z)-3-methyl-6-sulfanylhexa-3,5-dien-1-ol (PubChem CID 89366187) has the molecular formula C7H12OS and a molecular weight of 144.24 g/mol. Its IUPAC name is (3E,5Z)-3-methyl-6-sulfanylhexa-3,5-dien-1-ol.
| Compound Name | (3E,5Z)-3-methyl-6-sulfanylhexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 89366187 |
| Molecular Formula | C7H12OS |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | (3E,5Z)-3-methyl-6-sulfanylhexa-3,5-dien-1-ol |
| SMILES | C/C(=C\C=C/S)CCO |
| InChI | InChI=1S/C7H12OS/c1-7(4-5-8)3-2-6-9/h2-3,6,8-9H,4-5H2,1H3/b6-2-,7-3+ |
| InChIKey | UXMHMBBAVJVWIV-MFDSWNTHSA-N |
| XLogP | 1.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|