C10H18OS — CID 143683535
(4Z,6E)-7-methyl-8-sulfanylnona-4,6-dien-2-ol (PubChem CID 143683535) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is (4Z,6E)-7-methyl-8-sulfanylnona-4,6-dien-2-ol.
| Compound Name | (4Z,6E)-7-methyl-8-sulfanylnona-4,6-dien-2-ol |
|---|---|
| PubChem CID | 143683535 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (4Z,6E)-7-methyl-8-sulfanylnona-4,6-dien-2-ol |
| SMILES | C/C(=C\C=C/CC(C)O)C(C)S |
| InChI | InChI=1S/C10H18OS/c1-8(10(3)12)6-4-5-7-9(2)11/h4-6,9-12H,7H2,1-3H3/b5-4-,8-6+ |
| InChIKey | HWMKJBCFDAXZLA-GSGSLZOQSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|