About ethane;(4Z)-5-methylhepta-4,6-dien-2-ol
ethane;(4Z)-5-methylhepta-4,6-dien-2-ol (PubChem CID 143259573) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is ethane;(4Z)-5-methylhepta-4,6-dien-2-ol.
Molecular Properties
| Compound Name | ethane;(4Z)-5-methylhepta-4,6-dien-2-ol |
| PubChem CID | 143259573 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | ethane;(4Z)-5-methylhepta-4,6-dien-2-ol |
| SMILES | C=C/C(C)=C\CC(C)O.CC |
| InChI | InChI=1S/C8H14O.C2H6/c1-4-7(2)5-6-8(3)9;1-2/h4-5,8-9H,1,6H2,2-3H3;1-2H3/b7-5-; |
| InChIKey | AJZZOWMWLDNSDH-YJOCEBFMSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4Z)-5-methylhepta-4,6-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4Z)-5-methylhepta-4,6-dien-2-ol?
The IUPAC name of ethane;(4Z)-5-methylhepta-4,6-dien-2-ol (CID 143259573) is ethane;(4Z)-5-methylhepta-4,6-dien-2-ol.
What is the SMILES notation for ethane;(4Z)-5-methylhepta-4,6-dien-2-ol?
The canonical SMILES for ethane;(4Z)-5-methylhepta-4,6-dien-2-ol is C=C/C(C)=C\CC(C)O.CC.
What is the InChIKey of ethane;(4Z)-5-methylhepta-4,6-dien-2-ol?
The InChIKey is AJZZOWMWLDNSDH-YJOCEBFMSA-N. The full InChI is InChI=1S/C8H14O.C2H6/c1-4-7(2)5-6-8(3)9;1-2/h4-5,8-9H,1,6H2,2-3H3;1-2H3/b7-5-;.
What are the key properties of ethane;(4Z)-5-methylhepta-4,6-dien-2-ol?
ethane;(4Z)-5-methylhepta-4,6-dien-2-ol has a molecular weight of 156.27 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4Z)-5-methylhepta-4,6-dien-2-ol is sourced from PubChem (CID 143259573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).