C10H20OS — CID 144974171
ethane;(E,2E)-2-ethylidene-3-(sulfanylmethyl)pent-3-en-1-ol (PubChem CID 144974171) has the molecular formula C10H20OS and a molecular weight of 188.34 g/mol. Its IUPAC name is ethane;(E,2E)-2-ethylidene-3-(sulfanylmethyl)pent-3-en-1-ol.
| Compound Name | ethane;(E,2E)-2-ethylidene-3-(sulfanylmethyl)pent-3-en-1-ol |
|---|---|
| PubChem CID | 144974171 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | ethane;(E,2E)-2-ethylidene-3-(sulfanylmethyl)pent-3-en-1-ol |
| SMILES | C/C=C(CO)\C(=C/C)CS.CC |
| InChI | InChI=1S/C8H14OS.C2H6/c1-3-7(5-9)8(4-2)6-10;1-2/h3-4,9-10H,5-6H2,1-2H3;1-2H3/b7-3-,8-4-; |
| InChIKey | FDPUELOTFZTFDI-FQXRMGPMSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|