C13H22OS2 — CID 145098769
(3E,5Z)-4-(tert-butyldisulfanyl)-3-ethenylhepta-3,5-dien-1-ol (PubChem CID 145098769) has the molecular formula C13H22OS2 and a molecular weight of 258.45 g/mol. Its IUPAC name is (3E,5Z)-4-(tert-butyldisulfanyl)-3-ethenylhepta-3,5-dien-1-ol.
| Compound Name | (3E,5Z)-4-(tert-butyldisulfanyl)-3-ethenylhepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 145098769 |
| Molecular Formula | C13H22OS2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (3E,5Z)-4-(tert-butyldisulfanyl)-3-ethenylhepta-3,5-dien-1-ol |
| SMILES | C=C/C(CCO)=C(\C=C/C)SSC(C)(C)C |
| InChI | InChI=1S/C13H22OS2/c1-6-8-12(11(7-2)9-10-14)15-16-13(3,4)5/h6-8,14H,2,9-10H2,1,3-5H3/b8-6-,12-11- |
| InChIKey | VAAQGTJBZORVLW-LEZADOBDSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|