C13H20N2O4 — CID 24906039
tert-butyl N-[(1S)-1-(5-formyl-1,3-oxazol-2-yl)-2-methylpropyl]carbamate (PubChem CID 24906039) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(5-formyl-1,3-oxazol-2-yl)-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(5-formyl-1,3-oxazol-2-yl)-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 24906039 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | tert-butyl N-[(1S)-1-(5-formyl-1,3-oxazol-2-yl)-2-methylpropyl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)c1ncc(C=O)o1 |
| InChI | InChI=1S/C13H20N2O4/c1-8(2)10(11-14-6-9(7-16)18-11)15-12(17)19-13(3,4)5/h6-8,10H,1-5H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | BQJJNVLLZACOAP-JTQLQIEISA-N |
| XLogP | 2.71 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|