C13H20F3N3O2 — CID 102970448
tert-butyl N-[(1S)-2-methyl-1-[5-(trifluoromethyl)-1H-imidazol-2-yl]propyl]carbamate (PubChem CID 102970448) has the molecular formula C13H20F3N3O2 and a molecular weight of 307.32 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-methyl-1-[5-(trifluoromethyl)-1H-imidazol-2-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-methyl-1-[5-(trifluoromethyl)-1H-imidazol-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 102970448 |
| Molecular Formula | C13H20F3N3O2 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | tert-butyl N-[(1S)-2-methyl-1-[5-(trifluoromethyl)-1H-imidazol-2-yl]propyl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)c1ncc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C13H20F3N3O2/c1-7(2)9(19-11(20)21-12(3,4)5)10-17-6-8(18-10)13(14,15)16/h6-7,9H,1-5H3,(H,17,18)(H,19,20)/t9-/m0/s1 |
| InChIKey | HFUOENMWIHHOSP-VIFPVBQESA-N |
| XLogP | 3.65 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |