C19H25N5 — CID 24911684
6-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24911684) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 6-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24911684 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 6-[(2,5-dimethyl-1H-pyrrol-3-yl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Cc1cc(CN2CCc3nc(C4=NCCCC4)ncc3C2)c(C)[nH]1 |
| InChI | InChI=1S/C19H25N5/c1-13-9-15(14(2)22-13)11-24-8-6-17-16(12-24)10-21-19(23-17)18-5-3-4-7-20-18/h9-10,22H,3-8,11-12H2,1-2H3 |
| InChIKey | UZIXQWJLMGKHCP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |