C19H20Cl2N4 — CID 24928508
6-[(2,4-dichlorophenyl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24928508) has the molecular formula C19H20Cl2N4 and a molecular weight of 375.30 g/mol. Its IUPAC name is 6-[(2,4-dichlorophenyl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(2,4-dichlorophenyl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24928508 |
| Molecular Formula | C19H20Cl2N4 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 6-[(2,4-dichlorophenyl)methyl]-2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Clc1ccc(CN2CCc3nc(C4=NCCCC4)ncc3C2)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N4/c20-15-5-4-13(16(21)9-15)11-25-8-6-17-14(12-25)10-23-19(24-17)18-3-1-2-7-22-18/h4-5,9-10H,1-3,6-8,11-12H2 |
| InChIKey | NDUUBGXBPPQGKH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |