C22H20Cl2N4O2 — CID 24909458
6,8-dichloro-3-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-4-one (PubChem CID 24909458) has the molecular formula C22H20Cl2N4O2 and a molecular weight of 443.33 g/mol. Its IUPAC name is 6,8-dichloro-3-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-4-one.
| Compound Name | 6,8-dichloro-3-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 24909458 |
| Molecular Formula | C22H20Cl2N4O2 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 6,8-dichloro-3-[[2-(2,3,4,5-tetrahydropyridin-6-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-4-one |
| SMILES | O=c1c(CN2CCc3nc(C4=NCCCC4)ncc3C2)coc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C22H20Cl2N4O2/c23-15-7-16-20(29)14(12-30-21(16)17(24)8-15)11-28-6-4-18-13(10-28)9-26-22(27-18)19-3-1-2-5-25-19/h7-9,12H,1-6,10-11H2 |
| InChIKey | HXMQNSUIOZIEIW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |