C23H22N6 — CID 24912385
6-[(1-prop-2-enylindol-3-yl)methyl]-2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24912385) has the molecular formula C23H22N6 and a molecular weight of 382.47 g/mol. Its IUPAC name is 6-[(1-prop-2-enylindol-3-yl)methyl]-2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(1-prop-2-enylindol-3-yl)methyl]-2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24912385 |
| Molecular Formula | C23H22N6 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 6-[(1-prop-2-enylindol-3-yl)methyl]-2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | C=CCn1cc(CN2CCc3nc(-c4cncnc4)ncc3C2)c2ccccc21 |
| InChI | InChI=1S/C23H22N6/c1-2-8-29-15-19(20-5-3-4-6-22(20)29)14-28-9-7-21-18(13-28)12-26-23(27-21)17-10-24-16-25-11-17/h2-6,10-12,15-16H,1,7-9,13-14H2 |
| InChIKey | YJFVKTQVFCTAKI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|