C25H25N5 — CID 24912387
4-[6-[(1-prop-2-enylindol-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24912387) has the molecular formula C25H25N5 and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-[6-[(1-prop-2-enylindol-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[(1-prop-2-enylindol-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24912387 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-[6-[(1-prop-2-enylindol-3-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | C=CCn1cc(CN2CCc3nc(-c4ccc(N)cc4)ncc3C2)c2ccccc21 |
| InChI | InChI=1S/C25H25N5/c1-2-12-30-17-20(22-5-3-4-6-24(22)30)16-29-13-11-23-19(15-29)14-27-25(28-23)18-7-9-21(26)10-8-18/h2-10,14,17H,1,11-13,15-16,26H2 |
| InChIKey | KKTHTWLWAJAJBZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|