C20H17FN4O4 — CID 24913037
3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]-6-fluoro-8-nitrochromen-4-one (PubChem CID 24913037) has the molecular formula C20H17FN4O4 and a molecular weight of 396.38 g/mol. Its IUPAC name is 3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]-6-fluoro-8-nitrochromen-4-one.
| Compound Name | 3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]-6-fluoro-8-nitrochromen-4-one |
|---|---|
| PubChem CID | 24913037 |
| Molecular Formula | C20H17FN4O4 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-[(2-cyclopropyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]-6-fluoro-8-nitrochromen-4-one |
| SMILES | O=c1c(CN2CCc3nc(C4CC4)ncc3C2)coc2c([N+](=O)[O-])cc(F)cc12 |
| InChI | InChI=1S/C20H17FN4O4/c21-14-5-15-18(26)13(10-29-19(15)17(6-14)25(27)28)9-24-4-3-16-12(8-24)7-22-20(23-16)11-1-2-11/h5-7,10-11H,1-4,8-9H2 |
| InChIKey | GGFVTHJDOSQYLN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|