C18H13F3N4O4 — CID 24910548
6-nitro-3-[[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-4-one (PubChem CID 24910548) has the molecular formula C18H13F3N4O4 and a molecular weight of 406.32 g/mol. Its IUPAC name is 6-nitro-3-[[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-4-one.
| Compound Name | 6-nitro-3-[[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 24910548 |
| Molecular Formula | C18H13F3N4O4 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 6-nitro-3-[[2-(trifluoromethyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]methyl]chromen-4-one |
| SMILES | O=c1c(CN2CCc3nc(C(F)(F)F)ncc3C2)coc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C18H13F3N4O4/c19-18(20,21)17-22-6-10-7-24(4-3-14(10)23-17)8-11-9-29-15-2-1-12(25(27)28)5-13(15)16(11)26/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | PSIWMFWYIYIEQO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|