C16H22N4O2S — CID 24919708
6-[[5-(diethylamino)furan-2-yl]methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 24919708) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 6-[[5-(diethylamino)furan-2-yl]methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[5-(diethylamino)furan-2-yl]methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24919708 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 6-[[5-(diethylamino)furan-2-yl]methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCN(CC)c1ccc(CN2CCc3[nH]c(=S)[nH]c(=O)c3C2)o1 |
| InChI | InChI=1S/C16H22N4O2S/c1-3-20(4-2)14-6-5-11(22-14)9-19-8-7-13-12(10-19)15(21)18-16(23)17-13/h5-6H,3-4,7-10H2,1-2H3,(H2,17,18,21,23) |
| InChIKey | VOFMDCDNDUAZHI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|