C15H16ClN3O2S — CID 24929101
6-[(2-chloro-3-hydroxy-4-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24929101) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is 6-[(2-chloro-3-hydroxy-4-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(2-chloro-3-hydroxy-4-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24929101 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 6-[(2-chloro-3-hydroxy-4-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | COc1ccc(CN2CCc3[nH]c(=S)ncc3C2)c(Cl)c1O |
| InChI | InChI=1S/C15H16ClN3O2S/c1-21-12-3-2-9(13(16)14(12)20)7-19-5-4-11-10(8-19)6-17-15(22)18-11/h2-3,6,20H,4-5,7-8H2,1H3,(H,17,18,22) |
| InChIKey | PWSLRAKLOCMPGN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|