C16H18ClN3O2S — CID 24929059
6-[(2-chloro-3,4-dimethoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24929059) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 6-[(2-chloro-3,4-dimethoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(2-chloro-3,4-dimethoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24929059 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 6-[(2-chloro-3,4-dimethoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | COc1ccc(CN2CCc3[nH]c(=S)ncc3C2)c(Cl)c1OC |
| InChI | InChI=1S/C16H18ClN3O2S/c1-21-13-4-3-10(14(17)15(13)22-2)8-20-6-5-12-11(9-20)7-18-16(23)19-12/h3-4,7H,5-6,8-9H2,1-2H3,(H,18,19,23) |
| InChIKey | ILWMRXBSVNJXHM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|