C22H18ClN5O2 — CID 24930947
2-(4-chlorophenyl)-7-[(4-nitro-1H-indol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine (PubChem CID 24930947) has the molecular formula C22H18ClN5O2 and a molecular weight of 419.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-[(4-nitro-1H-indol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine.
| Compound Name | 2-(4-chlorophenyl)-7-[(4-nitro-1H-indol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 24930947 |
| Molecular Formula | C22H18ClN5O2 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-(4-chlorophenyl)-7-[(4-nitro-1H-indol-3-yl)methyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc2[nH]cc(CN3CCc4cnc(-c5ccc(Cl)cc5)nc4C3)c12 |
| InChI | InChI=1S/C22H18ClN5O2/c23-17-6-4-14(5-7-17)22-25-10-15-8-9-27(13-19(15)26-22)12-16-11-24-18-2-1-3-20(21(16)18)28(29)30/h1-7,10-11,24H,8-9,12-13H2 |
| InChIKey | FYBRRRHFUZKLOV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|