C22H23N3O7 — CID 2493582
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl (E)-2-cyano-3-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 2493582) has the molecular formula C22H23N3O7 and a molecular weight of 441.44 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (E)-2-cyano-3-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (E)-2-cyano-3-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2493582 |
| Molecular Formula | C22H23N3O7 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (E)-2-cyano-3-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | COCCn1c(C)cc(/C=C(\C#N)C(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)c1C |
| InChI | InChI=1S/C22H23N3O7/c1-14-6-16(15(2)24(14)4-5-29-3)7-17(10-23)22(26)31-12-19-9-20(25(27)28)8-18-11-30-13-32-21(18)19/h6-9H,4-5,11-13H2,1-3H3/b17-7+ |
| InChIKey | FHEIKRWUSUNTBG-REZTVBANSA-N |
| XLogP | 3.18 |
| TPSA | 125.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|