C24H24ClN3O3S — CID 43023284
(2-chloro-7-methylsulfanylquinolin-3-yl)methyl (E)-2-cyano-3-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 43023284) has the molecular formula C24H24ClN3O3S and a molecular weight of 469.99 g/mol. Its IUPAC name is (2-chloro-7-methylsulfanylquinolin-3-yl)methyl (E)-2-cyano-3-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl (E)-2-cyano-3-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 43023284 |
| Molecular Formula | C24H24ClN3O3S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl (E)-2-cyano-3-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | COCCn1c(C)cc(/C=C(\C#N)C(=O)OCc2cc3ccc(SC)cc3nc2Cl)c1C |
| InChI | InChI=1S/C24H24ClN3O3S/c1-15-9-18(16(2)28(15)7-8-30-3)11-19(13-26)24(29)31-14-20-10-17-5-6-21(32-4)12-22(17)27-23(20)25/h5-6,9-12H,7-8,14H2,1-4H3/b19-11+ |
| InChIKey | WGVUDIIPPOBCBB-YBFXNURJSA-N |
| XLogP | 5.33 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|