About S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate
S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate (PubChem CID 24938529) has the molecular formula C15H11NO3S
and a molecular weight of 285.32 g/mol. Its IUPAC name is S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate.
Molecular Properties
| Compound Name | S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate |
| PubChem CID | 24938529 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate |
| SMILES | O=C(/C=C/c1ccccc1)Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11NO3S/c17-15(11-6-12-4-2-1-3-5-12)20-14-9-7-13(8-10-14)16(18)19/h1-11H/b11-6+ |
| InChIKey | IFNKNTBLTUDPSF-IZZDOVSWSA-N |
| XLogP | 3.93 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate?
The IUPAC name of S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate (CID 24938529) is S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate.
What is the SMILES notation for S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate?
The canonical SMILES for S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate is O=C(/C=C/c1ccccc1)Sc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate?
The InChIKey is IFNKNTBLTUDPSF-IZZDOVSWSA-N. The full InChI is InChI=1S/C15H11NO3S/c17-15(11-6-12-4-2-1-3-5-12)20-14-9-7-13(8-10-14)16(18)19/h1-11H/b11-6+.
What are the key properties of S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate?
S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate has a molecular weight of 285.32 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-nitrophenyl) (E)-3-phenylprop-2-enethioate is sourced from PubChem (CID 24938529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).