C17H16N4OS — CID 24938684
N-[(Z)-(4-methyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]quinoline-2-carboxamide (PubChem CID 24938684) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[(Z)-(4-methyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]quinoline-2-carboxamide.
| Compound Name | N-[(Z)-(4-methyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 24938684 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[(Z)-(4-methyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]quinoline-2-carboxamide |
| SMILES | C=CCn1c(C)cs/c1=N\NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H16N4OS/c1-3-10-21-12(2)11-23-17(21)20-19-16(22)15-9-8-13-6-4-5-7-14(13)18-15/h3-9,11H,1,10H2,2H3,(H,19,22)/b20-17- |
| InChIKey | NUMOSOBWIZOJBZ-JZJYNLBNSA-N |
| XLogP | 2.84 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|