C21H18N4OS — CID 24938564
N-[(Z)-(3-benzyl-4-methyl-1,3-thiazol-2-ylidene)amino]quinoline-2-carboxamide (PubChem CID 24938564) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[(Z)-(3-benzyl-4-methyl-1,3-thiazol-2-ylidene)amino]quinoline-2-carboxamide.
| Compound Name | N-[(Z)-(3-benzyl-4-methyl-1,3-thiazol-2-ylidene)amino]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 24938564 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-[(Z)-(3-benzyl-4-methyl-1,3-thiazol-2-ylidene)amino]quinoline-2-carboxamide |
| SMILES | Cc1cs/c(=N\NC(=O)c2ccc3ccccc3n2)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H18N4OS/c1-15-14-27-21(25(15)13-16-7-3-2-4-8-16)24-23-20(26)19-12-11-17-9-5-6-10-18(17)22-19/h2-12,14H,13H2,1H3,(H,23,26)/b24-21- |
| InChIKey | SDBVHKZOADZSQK-FLFQWRMESA-N |
| XLogP | 3.70 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|