C22H16N2O3S — CID 58191384
2-(4-methylphenyl)-4-(quinoline-2-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 58191384) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4-(quinoline-2-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 2-(4-methylphenyl)-4-(quinoline-2-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58191384 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-(4-methylphenyl)-4-(quinoline-2-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2scc(NC(=O)c3ccc4ccccc4n3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C22H16N2O3S/c1-13-6-8-15(9-7-13)20-19(22(26)27)18(12-28-20)24-21(25)17-11-10-14-4-2-3-5-16(14)23-17/h2-12H,1H3,(H,24,25)(H,26,27) |
| InChIKey | YJTJDZBKIJRDIP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |