C35H55NO11S2 — CID 24941912
[(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[S-ethyl-N-(4-methylphenyl)sulfonylsulfinimidoyl]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 24941912) has the molecular formula C35H55NO11S2 and a molecular weight of 729.96 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[S-ethyl-N-(4-methylphenyl)sulfonylsulfinimidoyl]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[S-ethyl-N-(4-methylphenyl)sulfonylsulfinimidoyl]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24941912 |
| Molecular Formula | C35H55NO11S2 |
| Molecular Weight | 729.96 g/mol |
| Exact Mass | 729.32 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[S-ethyl-N-(4-methylphenyl)sulfonylsulfinimidoyl]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC/S(=N\S(=O)(=O)c1ccc(C)cc1)[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C35H55NO11S2/c1-15-48(36-49(41,42)22-18-16-21(2)17-19-22)27-26(47-31(40)35(12,13)14)25(46-30(39)34(9,10)11)24(45-29(38)33(6,7)8)23(44-27)20-43-28(37)32(3,4)5/h16-19,23-27H,15,20H2,1-14H3/t23-,24-,25+,26-,27+,48?/m1/s1 |
| InChIKey | BQNPAOPSLNXMAG-APSZPSSHSA-N |
| XLogP | 5.69 |
| TPSA | 160.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.96 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|