C21H19NO2S2 — CID 24944979
N-hydroxy-2-[2-[4-(4-methylsulfanylphenyl)phenyl]sulfanylphenyl]acetamide (PubChem CID 24944979) has the molecular formula C21H19NO2S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-hydroxy-2-[2-[4-(4-methylsulfanylphenyl)phenyl]sulfanylphenyl]acetamide.
| Compound Name | N-hydroxy-2-[2-[4-(4-methylsulfanylphenyl)phenyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 24944979 |
| Molecular Formula | C21H19NO2S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-hydroxy-2-[2-[4-(4-methylsulfanylphenyl)phenyl]sulfanylphenyl]acetamide |
| SMILES | CSc1ccc(-c2ccc(Sc3ccccc3CC(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C21H19NO2S2/c1-25-18-10-6-15(7-11-18)16-8-12-19(13-9-16)26-20-5-3-2-4-17(20)14-21(23)22-24/h2-13,24H,14H2,1H3,(H,22,23) |
| InChIKey | GLTMNRBKOJOJOG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|