C30H32N2O5S — CID 24945003
3-[2-ethoxyethyl-(4-methylcyclohexanecarbonyl)amino]-5-(4-furo[3,2-b]pyridin-2-ylphenyl)thiophene-2-carboxylic acid (PubChem CID 24945003) has the molecular formula C30H32N2O5S and a molecular weight of 532.66 g/mol. Its IUPAC name is 3-[2-ethoxyethyl-(4-methylcyclohexanecarbonyl)amino]-5-(4-furo[3,2-b]pyridin-2-ylphenyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[2-ethoxyethyl-(4-methylcyclohexanecarbonyl)amino]-5-(4-furo[3,2-b]pyridin-2-ylphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 24945003 |
| Molecular Formula | C30H32N2O5S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 3-[2-ethoxyethyl-(4-methylcyclohexanecarbonyl)amino]-5-(4-furo[3,2-b]pyridin-2-ylphenyl)thiophene-2-carboxylic acid |
| SMILES | CCOCCN(C(=O)C1CCC(C)CC1)c1cc(-c2ccc(-c3cc4ncccc4o3)cc2)sc1C(=O)O |
| InChI | InChI=1S/C30H32N2O5S/c1-3-36-16-15-32(29(33)22-8-6-19(2)7-9-22)24-18-27(38-28(24)30(34)35)21-12-10-20(11-13-21)26-17-23-25(37-26)5-4-14-31-23/h4-5,10-14,17-19,22H,3,6-9,15-16H2,1-2H3,(H,34,35) |
| InChIKey | BIVVMRWVJIYKFG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|