C22H27O3PS — CID 24948036
2-[1-diethoxyphosphoryl-2-(3-methylphenyl)ethyl]-3-methyl-1-benzothiophene (PubChem CID 24948036) has the molecular formula C22H27O3PS and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[1-diethoxyphosphoryl-2-(3-methylphenyl)ethyl]-3-methyl-1-benzothiophene.
| Compound Name | 2-[1-diethoxyphosphoryl-2-(3-methylphenyl)ethyl]-3-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 24948036 |
| Molecular Formula | C22H27O3PS |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[1-diethoxyphosphoryl-2-(3-methylphenyl)ethyl]-3-methyl-1-benzothiophene |
| SMILES | CCOP(=O)(OCC)C(Cc1cccc(C)c1)c1sc2ccccc2c1C |
| InChI | InChI=1S/C22H27O3PS/c1-5-24-26(23,25-6-2)20(15-18-11-9-10-16(3)14-18)22-17(4)19-12-7-8-13-21(19)27-22/h7-14,20H,5-6,15H2,1-4H3 |
| InChIKey | IOLMGELFICNBDC-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|