C29H42F3N3O — CID 24948315
N,N-dimethyl-3-[4-[4-(4-propan-2-ylpiperazin-1-yl)butyl]phenyl]-3-[4-(trifluoromethyl)phenoxy]propan-1-amine (PubChem CID 24948315) has the molecular formula C29H42F3N3O and a molecular weight of 505.67 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-[4-(4-propan-2-ylpiperazin-1-yl)butyl]phenyl]-3-[4-(trifluoromethyl)phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[4-[4-(4-propan-2-ylpiperazin-1-yl)butyl]phenyl]-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 24948315 |
| Molecular Formula | C29H42F3N3O |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | N,N-dimethyl-3-[4-[4-(4-propan-2-ylpiperazin-1-yl)butyl]phenyl]-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
| SMILES | CC(C)N1CCN(CCCCc2ccc(C(CCN(C)C)Oc3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H42F3N3O/c1-23(2)35-21-19-34(20-22-35)17-6-5-7-24-8-10-25(11-9-24)28(16-18-33(3)4)36-27-14-12-26(13-15-27)29(30,31)32/h8-15,23,28H,5-7,16-22H2,1-4H3 |
| InChIKey | XMPORTBQJZQMQJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|