C19H22N4S2 — CID 24949693
2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-1,3-benzothiazole (PubChem CID 24949693) has the molecular formula C19H22N4S2 and a molecular weight of 370.55 g/mol. Its IUPAC name is 2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 24949693 |
| Molecular Formula | C19H22N4S2 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[3-(4-pyridin-2-ylpiperazin-1-yl)propylsulfanyl]-1,3-benzothiazole |
| SMILES | c1ccc(N2CCN(CCCSc3nc4ccccc4s3)CC2)nc1 |
| InChI | InChI=1S/C19H22N4S2/c1-2-7-17-16(6-1)21-19(25-17)24-15-5-10-22-11-13-23(14-12-22)18-8-3-4-9-20-18/h1-4,6-9H,5,10-15H2 |
| InChIKey | WFKQHFRAVGTTCE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|