C24H27N7O3S — CID 24952339
2-[5-[2-(methylamino)ethoxy]-3-oxo-1H-isoindol-2-yl]-N-(4-piperazin-1-yl-3-pyridinyl)-1,3-thiazole-4-carboxamide (PubChem CID 24952339) has the molecular formula C24H27N7O3S and a molecular weight of 493.59 g/mol. Its IUPAC name is 2-[5-[2-(methylamino)ethoxy]-3-oxo-1H-isoindol-2-yl]-N-(4-piperazin-1-yl-3-pyridinyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[5-[2-(methylamino)ethoxy]-3-oxo-1H-isoindol-2-yl]-N-(4-piperazin-1-yl-3-pyridinyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 24952339 |
| Molecular Formula | C24H27N7O3S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 2-[5-[2-(methylamino)ethoxy]-3-oxo-1H-isoindol-2-yl]-N-(4-piperazin-1-yl-3-pyridinyl)-1,3-thiazole-4-carboxamide |
| SMILES | CNCCOc1ccc2c(c1)C(=O)N(c1nc(C(=O)Nc3cnccc3N3CCNCC3)cs1)C2 |
| InChI | InChI=1S/C24H27N7O3S/c1-25-8-11-34-17-3-2-16-14-31(23(33)18(16)12-17)24-29-20(15-35-24)22(32)28-19-13-27-5-4-21(19)30-9-6-26-7-10-30/h2-5,12-13,15,25-26H,6-11,14H2,1H3,(H,28,32) |
| InChIKey | HIQXQHZLQSOAOD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|