C9H15NO3S — CID 24952897
ethyl (2S,4S)-1-acetyl-4-sulfanylpyrrolidine-2-carboxylate (PubChem CID 24952897) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is ethyl (2S,4S)-1-acetyl-4-sulfanylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4S)-1-acetyl-4-sulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 24952897 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | ethyl (2S,4S)-1-acetyl-4-sulfanylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](S)CN1C(C)=O |
| InChI | InChI=1S/C9H15NO3S/c1-3-13-9(12)8-4-7(14)5-10(8)6(2)11/h7-8,14H,3-5H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | DZUPHXJIOCBOAR-YUMQZZPRSA-N |
| XLogP | 0.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|