C29H29ClFN3O — CID 24953029
7-chloro-3-(3,5-dimethylphenyl)-6-(6-fluoro-3-pyridinyl)-4-[2-[(2R)-piperidin-2-yl]ethoxy]quinoline (PubChem CID 24953029) has the molecular formula C29H29ClFN3O and a molecular weight of 490.02 g/mol. Its IUPAC name is 7-chloro-3-(3,5-dimethylphenyl)-6-(6-fluoro-3-pyridinyl)-4-[2-[(2R)-piperidin-2-yl]ethoxy]quinoline.
| Compound Name | 7-chloro-3-(3,5-dimethylphenyl)-6-(6-fluoro-3-pyridinyl)-4-[2-[(2R)-piperidin-2-yl]ethoxy]quinoline |
|---|---|
| PubChem CID | 24953029 |
| Molecular Formula | C29H29ClFN3O |
| Molecular Weight | 490.02 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 7-chloro-3-(3,5-dimethylphenyl)-6-(6-fluoro-3-pyridinyl)-4-[2-[(2R)-piperidin-2-yl]ethoxy]quinoline |
| SMILES | Cc1cc(C)cc(-c2cnc3cc(Cl)c(-c4ccc(F)nc4)cc3c2OCC[C@H]2CCCCN2)c1 |
| InChI | InChI=1S/C29H29ClFN3O/c1-18-11-19(2)13-21(12-18)25-17-33-27-15-26(30)23(20-6-7-28(31)34-16-20)14-24(27)29(25)35-10-8-22-5-3-4-9-32-22/h6-7,11-17,22,32H,3-5,8-10H2,1-2H3/t22-/m1/s1 |
| InChIKey | ONAXVGKTABLQEW-JOCHJYFZSA-N |
| XLogP | 7.28 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.02 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|