C29H29Cl2N3O — CID 52936724
7-chloro-6-(6-chloro-3-pyridinyl)-3-(3,5-dimethylphenyl)-4-[2-[(2R)-piperidin-2-yl]ethoxy]quinoline (PubChem CID 52936724) has the molecular formula C29H29Cl2N3O and a molecular weight of 506.48 g/mol. Its IUPAC name is 7-chloro-6-(6-chloro-3-pyridinyl)-3-(3,5-dimethylphenyl)-4-[2-[(2R)-piperidin-2-yl]ethoxy]quinoline.
| Compound Name | 7-chloro-6-(6-chloro-3-pyridinyl)-3-(3,5-dimethylphenyl)-4-[2-[(2R)-piperidin-2-yl]ethoxy]quinoline |
|---|---|
| PubChem CID | 52936724 |
| Molecular Formula | C29H29Cl2N3O |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 7-chloro-6-(6-chloro-3-pyridinyl)-3-(3,5-dimethylphenyl)-4-[2-[(2R)-piperidin-2-yl]ethoxy]quinoline |
| SMILES | Cc1cc(C)cc(-c2cnc3cc(Cl)c(-c4ccc(Cl)nc4)cc3c2OCC[C@H]2CCCCN2)c1 |
| InChI | InChI=1S/C29H29Cl2N3O/c1-18-11-19(2)13-21(12-18)25-17-33-27-15-26(30)23(20-6-7-28(31)34-16-20)14-24(27)29(25)35-10-8-22-5-3-4-9-32-22/h6-7,11-17,22,32H,3-5,8-10H2,1-2H3/t22-/m1/s1 |
| InChIKey | QCWLANQJEJNBMW-JOCHJYFZSA-N |
| XLogP | 7.80 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|