C19H25BrN4O8 — CID 24953443
(2S)-2-[[(1S)-5-[(4-bromophenyl)carbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 24953443) has the molecular formula C19H25BrN4O8 and a molecular weight of 517.33 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[(4-bromophenyl)carbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[(4-bromophenyl)carbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 24953443 |
| Molecular Formula | C19H25BrN4O8 |
| Molecular Weight | 517.33 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | (2S)-2-[[(1S)-5-[(4-bromophenyl)carbamoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)Nc1ccc(Br)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H25BrN4O8/c20-11-4-6-12(7-5-11)22-18(31)21-10-2-1-3-13(16(27)28)23-19(32)24-14(17(29)30)8-9-15(25)26/h4-7,13-14H,1-3,8-10H2,(H,25,26)(H,27,28)(H,29,30)(H2,21,22,31)(H2,23,24,32)/t13-,14-/m0/s1 |
| InChIKey | KRBIFVSYVYPEFJ-KBPBESRZSA-N |
| XLogP | 1.81 |
| TPSA | 194.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|