C18H26BrN3O4 — CID 71519685
(2S)-2-[[(2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]pentanoic acid (PubChem CID 71519685) has the molecular formula C18H26BrN3O4 and a molecular weight of 428.33 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 71519685 |
| Molecular Formula | C18H26BrN3O4 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)Nc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C18H26BrN3O4/c1-4-5-14(17(24)25)21-16(23)15(10-11(2)3)22-18(26)20-13-8-6-12(19)7-9-13/h6-9,11,14-15H,4-5,10H2,1-3H3,(H,21,23)(H,24,25)(H2,20,22,26)/t14-,15-/m0/s1 |
| InChIKey | LZDASXAVFDPLHY-GJZGRUSLSA-N |
| XLogP | 3.35 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |