C13H14F2N2O3 — CID 24954204
2-(difluoromethyl)-5-pentyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 24954204) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-pentyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-(difluoromethyl)-5-pentyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24954204 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(difluoromethyl)-5-pentyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCCCCc1cc(=O)oc2nc(C(F)F)[nH]c(=O)c12 |
| InChI | InChI=1S/C13H14F2N2O3/c1-2-3-4-5-7-6-8(18)20-13-9(7)12(19)16-11(17-13)10(14)15/h6,10H,2-5H2,1H3,(H,16,17,19) |
| InChIKey | NHAKVIYYEYMPDA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|