C28H35F4N5O2 — CID 24955370
(2S)-N-[(3R)-3-amino-4,4-difluorobutyl]-N-[1-[5-(2,5-difluorophenyl)-2-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-2-hydroxypropanamide (PubChem CID 24955370) has the molecular formula C28H35F4N5O2 and a molecular weight of 549.61 g/mol. Its IUPAC name is (2S)-N-[(3R)-3-amino-4,4-difluorobutyl]-N-[1-[5-(2,5-difluorophenyl)-2-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-2-hydroxypropanamide.
| Compound Name | (2S)-N-[(3R)-3-amino-4,4-difluorobutyl]-N-[1-[5-(2,5-difluorophenyl)-2-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 24955370 |
| Molecular Formula | C28H35F4N5O2 |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | (2S)-N-[(3R)-3-amino-4,4-difluorobutyl]-N-[1-[5-(2,5-difluorophenyl)-2-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-2-hydroxypropanamide |
| SMILES | Cc1cccc(Cn2nc(-c3cc(F)ccc3F)nc2C(N(CC[C@@H](N)C(F)F)C(=O)[C@H](C)O)C(C)(C)C)c1 |
| InChI | InChI=1S/C28H35F4N5O2/c1-16-7-6-8-18(13-16)15-37-26(34-25(35-37)20-14-19(29)9-10-21(20)30)23(28(3,4)5)36(27(39)17(2)38)12-11-22(33)24(31)32/h6-10,13-14,17,22-24,38H,11-12,15,33H2,1-5H3/t17-,22+,23?/m0/s1 |
| InChIKey | PLDLLMYORUZPHR-IRXMKASPSA-N |
| XLogP | 4.86 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |