C24H28F2N4O2 — CID 140527148
(3R)-3-[5-(2,5-difluorophenyl)-2-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]-2-hydroxy-2,4,4-trimethylpentanamide (PubChem CID 140527148) has the molecular formula C24H28F2N4O2 and a molecular weight of 442.51 g/mol. Its IUPAC name is (3R)-3-[5-(2,5-difluorophenyl)-2-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]-2-hydroxy-2,4,4-trimethylpentanamide.
| Compound Name | (3R)-3-[5-(2,5-difluorophenyl)-2-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]-2-hydroxy-2,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 140527148 |
| Molecular Formula | C24H28F2N4O2 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | (3R)-3-[5-(2,5-difluorophenyl)-2-[(3-methylphenyl)methyl]-1,2,4-triazol-3-yl]-2-hydroxy-2,4,4-trimethylpentanamide |
| SMILES | Cc1cccc(Cn2nc(-c3cc(F)ccc3F)nc2[C@@H](C(C)(C)C)C(C)(O)C(N)=O)c1 |
| InChI | InChI=1S/C24H28F2N4O2/c1-14-7-6-8-15(11-14)13-30-21(19(23(2,3)4)24(5,32)22(27)31)28-20(29-30)17-12-16(25)9-10-18(17)26/h6-12,19,32H,13H2,1-5H3,(H2,27,31)/t19-,24?/m0/s1 |
| InChIKey | NYYJLXMESUSBKR-XGLRFROISA-N |
| XLogP | 3.95 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |